Isomerism – Practice Questions

1.  How many different alkanes with C6H14 molecular formula can you make ?  Draw their skeletal formulae and name them.

2.  Which is the shortest chain-length alkane to have structural isomers?

3.  Draw all the isomers of C4H8 you can think of. Which are cis- and trans- isomers of each other?

4.  Draw skeletal formulae of cis-hex-3-ene and trans-hex-3-ene.

5.  Which of the following molecules has chiral centers, and where are they:

CH3CH2CH2CH­2CH­2OH

CH3CH2CH(NH2)CH3   

CH3CHClCH3                                         

CH3CH(OH)Br

CH3CH(CH3)CH(OH)CH(CH3)CH2CH3

6.  Draw the optical isomers of serine,  H2NCH(CH2OH)COOH

Click here to check your answers